C20H23FN4O5 — CID 156508272
2-[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]-3-fluoropiperidin-1-yl]acetic acid (PubChem CID 156508272) has the molecular formula C20H23FN4O5 and a molecular weight of 418.43 g/mol. Its IUPAC name is 2-[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]-3-fluoropiperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]-3-fluoropiperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 156508272 |
| Molecular Formula | C20H23FN4O5 |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 2-[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]-3-fluoropiperidin-1-yl]acetic acid |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(C3CCN(CC(=O)O)CC3F)cc21 |
| InChI | InChI=1S/C20H23FN4O5/c1-23-16-8-11(12-6-7-24(9-13(12)21)10-18(27)28)2-3-14(16)25(20(23)30)15-4-5-17(26)22-19(15)29/h2-3,8,12-13,15H,4-7,9-10H2,1H3,(H,27,28)(H,22,26,29) |
| InChIKey | LKZISARSWLNDEA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|