C22H29N3O5 — CID 167386252
10-[3-(2,6-dioxopiperidin-3-yl)-2-oxobenzimidazol-1-yl]decanoic acid (PubChem CID 167386252) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is 10-[3-(2,6-dioxopiperidin-3-yl)-2-oxobenzimidazol-1-yl]decanoic acid.
| Compound Name | 10-[3-(2,6-dioxopiperidin-3-yl)-2-oxobenzimidazol-1-yl]decanoic acid |
|---|---|
| PubChem CID | 167386252 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 10-[3-(2,6-dioxopiperidin-3-yl)-2-oxobenzimidazol-1-yl]decanoic acid |
| SMILES | O=C(O)CCCCCCCCCn1c(=O)n(C2CCC(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C22H29N3O5/c26-19-14-13-18(21(29)23-19)25-17-11-8-7-10-16(17)24(22(25)30)15-9-5-3-1-2-4-6-12-20(27)28/h7-8,10-11,18H,1-6,9,12-15H2,(H,27,28)(H,23,26,29) |
| InChIKey | AGWHWKQZVJHEBZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|