C17H23F2N3O3 — CID 171641902
3-[3-(difluoromethyl)-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;ethane (PubChem CID 171641902) has the molecular formula C17H23F2N3O3 and a molecular weight of 355.39 g/mol. Its IUPAC name is 3-[3-(difluoromethyl)-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;ethane.
| Compound Name | 3-[3-(difluoromethyl)-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;ethane |
|---|---|
| PubChem CID | 171641902 |
| Molecular Formula | C17H23F2N3O3 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 3-[3-(difluoromethyl)-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;ethane |
| SMILES | CC.CC.O=C1CCC(n2c(=O)n(C(F)F)c3ccccc32)C(=O)N1 |
| InChI | InChI=1S/C13H11F2N3O3.2C2H6/c14-12(15)18-8-4-2-1-3-7(8)17(13(18)21)9-5-6-10(19)16-11(9)20;2*1-2/h1-4,9,12H,5-6H2,(H,16,19,20);2*1-2H3 |
| InChIKey | RSJJMKWDEMKLBN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|