C15H13N3O3 — CID 162422025
3-(2-oxo-3-prop-2-ynylbenzimidazol-1-yl)piperidine-2,6-dione (PubChem CID 162422025) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 3-(2-oxo-3-prop-2-ynylbenzimidazol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(2-oxo-3-prop-2-ynylbenzimidazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 162422025 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-(2-oxo-3-prop-2-ynylbenzimidazol-1-yl)piperidine-2,6-dione |
| SMILES | C#CCn1c(=O)n(C2CCC(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C15H13N3O3/c1-2-9-17-10-5-3-4-6-11(10)18(15(17)21)12-7-8-13(19)16-14(12)20/h1,3-6,12H,7-9H2,(H,16,19,20) |
| InChIKey | DPQADGCZUOACRN-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|