C20H29N3O4Si — CID 150528335
3-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 150528335) has the molecular formula C20H29N3O4Si and a molecular weight of 403.56 g/mol. Its IUPAC name is 3-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 150528335 |
| Molecular Formula | C20H29N3O4Si |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 3-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCCn1c(=O)n(C2CCC(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C20H29N3O4Si/c1-20(2,3)28(4,5)27-13-12-22-14-8-6-7-9-15(14)23(19(22)26)16-10-11-17(24)21-18(16)25/h6-9,16H,10-13H2,1-5H3,(H,21,24,25) |
| InChIKey | IDHQNWDKQQXCOP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|