C25H29N3O3Si — CID 151743530
3-[4-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]pyrido[2,3-b]indol-9-yl]piperidine-2,6-dione (PubChem CID 151743530) has the molecular formula C25H29N3O3Si and a molecular weight of 447.61 g/mol. Its IUPAC name is 3-[4-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]pyrido[2,3-b]indol-9-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]pyrido[2,3-b]indol-9-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 151743530 |
| Molecular Formula | C25H29N3O3Si |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 3-[4-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]pyrido[2,3-b]indol-9-yl]piperidine-2,6-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCC#Cc1ccnc2c1c1ccccc1n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C25H29N3O3Si/c1-25(2,3)32(4,5)31-16-8-9-17-14-15-26-23-22(17)18-10-6-7-11-19(18)28(23)20-12-13-21(29)27-24(20)30/h6-7,10-11,14-15,20H,12-13,16H2,1-5H3,(H,27,29,30) |
| InChIKey | RNAMSTUEHSBGDH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|