C28H32N4O6 — CID 138727458
tert-butyl N-[2-[2-[3-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-5-yl]prop-2-ynoxy]ethoxy]ethyl]carbamate (PubChem CID 138727458) has the molecular formula C28H32N4O6 and a molecular weight of 520.59 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[3-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-5-yl]prop-2-ynoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[3-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-5-yl]prop-2-ynoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 138727458 |
| Molecular Formula | C28H32N4O6 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | tert-butyl N-[2-[2-[3-[9-(2,6-dioxopiperidin-3-yl)pyrido[2,3-b]indol-5-yl]prop-2-ynoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCC#Cc1cccc2c1c1cccnc1n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C28H32N4O6/c1-28(2,3)38-27(35)30-14-16-37-18-17-36-15-6-8-19-7-4-10-21-24(19)20-9-5-13-29-25(20)32(21)22-11-12-23(33)31-26(22)34/h4-5,7,9-10,13,22H,11-12,14-18H2,1-3H3,(H,30,35)(H,31,33,34) |
| InChIKey | GTOLKWSOWNTJLA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|