C24H30N4O5 — CID 166118450
tert-butyl N-[6-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]hex-5-ynyl]carbamate (PubChem CID 166118450) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is tert-butyl N-[6-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]hex-5-ynyl]carbamate.
| Compound Name | tert-butyl N-[6-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]hex-5-ynyl]carbamate |
|---|---|
| PubChem CID | 166118450 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | tert-butyl N-[6-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]hex-5-ynyl]carbamate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(C#CCCCCNC(=O)OC(C)(C)C)c21 |
| InChI | InChI=1S/C24H30N4O5/c1-24(2,3)33-22(31)25-15-8-6-5-7-10-16-11-9-12-17-20(16)27(4)23(32)28(17)18-13-14-19(29)26-21(18)30/h9,11-12,18H,5-6,8,13-15H2,1-4H3,(H,25,31)(H,26,29,30) |
| InChIKey | OUZZGRKLCRORHC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|