C33H47N5O5 — CID 156860774
tert-butyl N-methylcarbamate;3-[4-[2-[1-(cyclohexylmethyl)piperidin-4-yl]ethynyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 156860774) has the molecular formula C33H47N5O5 and a molecular weight of 593.77 g/mol. Its IUPAC name is tert-butyl N-methylcarbamate;3-[4-[2-[1-(cyclohexylmethyl)piperidin-4-yl]ethynyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | tert-butyl N-methylcarbamate;3-[4-[2-[1-(cyclohexylmethyl)piperidin-4-yl]ethynyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156860774 |
| Molecular Formula | C33H47N5O5 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.36 |
| IUPAC Name | tert-butyl N-methylcarbamate;3-[4-[2-[1-(cyclohexylmethyl)piperidin-4-yl]ethynyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | CNC(=O)OC(C)(C)C.Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(C#CC3CCN(CC4CCCCC4)CC3)c21 |
| InChI | InChI=1S/C27H34N4O3.C6H13NO2/c1-29-25-21(11-10-19-14-16-30(17-15-19)18-20-6-3-2-4-7-20)8-5-9-22(25)31(27(29)34)23-12-13-24(32)28-26(23)33;1-6(2,3)9-5(8)7-4/h5,8-9,19-20,23H,2-4,6-7,12-18H2,1H3,(H,28,32,33);1-4H3,(H,7,8) |
| InChIKey | OQNMWTDZTYUHHG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|