C19H24N4O5 — CID 138696063
tert-butyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]methyl]carbamate (PubChem CID 138696063) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is tert-butyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 138696063 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | tert-butyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]methyl]carbamate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(CNC(=O)OC(C)(C)C)c21 |
| InChI | InChI=1S/C19H24N4O5/c1-19(2,3)28-17(26)20-10-11-6-5-7-12-15(11)22(4)18(27)23(12)13-8-9-14(24)21-16(13)25/h5-7,13H,8-10H2,1-4H3,(H,20,26)(H,21,24,25) |
| InChIKey | PJVQGXLAKWERDP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|