C25H35N5O5 — CID 156861046
tert-butyl 4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propyl]piperazine-1-carboxylate (PubChem CID 156861046) has the molecular formula C25H35N5O5 and a molecular weight of 485.59 g/mol. Its IUPAC name is tert-butyl 4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 156861046 |
| Molecular Formula | C25H35N5O5 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | tert-butyl 4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propyl]piperazine-1-carboxylate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(CCCN3CCN(C(=O)OC(C)(C)C)CC3)c21 |
| InChI | InChI=1S/C25H35N5O5/c1-25(2,3)35-24(34)29-15-13-28(14-16-29)12-6-8-17-7-5-9-18-21(17)27(4)23(33)30(18)19-10-11-20(31)26-22(19)32/h5,7,9,19H,6,8,10-16H2,1-4H3,(H,26,31,32) |
| InChIKey | OBRNCZNAMXSERT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 105.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|