C27H40N4O8 — CID 138695774
tert-butyl N-[2-[2-[2-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 138695774) has the molecular formula C27H40N4O8 and a molecular weight of 548.64 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 138695774 |
| Molecular Formula | C27H40N4O8 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(CCCOCCOCCOCCNC(=O)OC(C)(C)C)c21 |
| InChI | InChI=1S/C27H40N4O8/c1-27(2,3)39-25(34)28-12-14-37-16-18-38-17-15-36-13-6-8-19-7-5-9-20-23(19)30(4)26(35)31(20)21-10-11-22(32)29-24(21)33/h5,7,9,21H,6,8,10-18H2,1-4H3,(H,28,34)(H,29,32,33) |
| InChIKey | MGMPNCXVXDDSCD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|