C23H31N3O7 — CID 138694928
tert-butyl N-[3-[3-[3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-benzoxazol-7-yl]propoxy]propyl]carbamate (PubChem CID 138694928) has the molecular formula C23H31N3O7 and a molecular weight of 461.52 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-benzoxazol-7-yl]propoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-benzoxazol-7-yl]propoxy]propyl]carbamate |
|---|---|
| PubChem CID | 138694928 |
| Molecular Formula | C23H31N3O7 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | tert-butyl N-[3-[3-[3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-benzoxazol-7-yl]propoxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOCCCc1cccc2c1oc(=O)n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C23H31N3O7/c1-23(2,3)33-21(29)24-12-6-14-31-13-5-8-15-7-4-9-16-19(15)32-22(30)26(16)17-10-11-18(27)25-20(17)28/h4,7,9,17H,5-6,8,10-14H2,1-3H3,(H,24,29)(H,25,27,28) |
| InChIKey | TYCUWIHEUNOBBO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|