C13H12N2O5 — CID 171781790
3-[7-(hydroxymethyl)-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione (PubChem CID 171781790) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 3-[7-(hydroxymethyl)-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-(hydroxymethyl)-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171781790 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-[7-(hydroxymethyl)-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(n2c(=O)oc3c(CO)cccc32)C(=O)N1 |
| InChI | InChI=1S/C13H12N2O5/c16-6-7-2-1-3-8-11(7)20-13(19)15(8)9-4-5-10(17)14-12(9)18/h1-3,9,16H,4-6H2,(H,14,17,18) |
| InChIKey | HTJXMDSWYALURM-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|