C16H15N3O4 — CID 171488084
3-[5-(hydroxymethyl)-1-oxo-3H-imidazo[1,5-a]indol-2-yl]piperidine-2,6-dione (PubChem CID 171488084) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is 3-[5-(hydroxymethyl)-1-oxo-3H-imidazo[1,5-a]indol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-(hydroxymethyl)-1-oxo-3H-imidazo[1,5-a]indol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171488084 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-[5-(hydroxymethyl)-1-oxo-3H-imidazo[1,5-a]indol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc4c(CO)cccc4n3C2=O)C(=O)N1 |
| InChI | InChI=1S/C16H15N3O4/c20-8-9-2-1-3-12-11(9)6-10-7-18(16(23)19(10)12)13-4-5-14(21)17-15(13)22/h1-3,6,13,20H,4-5,7-8H2,(H,17,21,22) |
| InChIKey | PNIAJELPUBNQCL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|