C14H14N2O2 — CID 138467080
3-(3-methylindol-1-yl)piperidine-2,6-dione (PubChem CID 138467080) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-(3-methylindol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(3-methylindol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 138467080 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-(3-methylindol-1-yl)piperidine-2,6-dione |
| SMILES | Cc1cn(C2CCC(=O)NC2=O)c2ccccc12 |
| InChI | InChI=1S/C14H14N2O2/c1-9-8-16(11-5-3-2-4-10(9)11)12-6-7-13(17)15-14(12)18/h2-5,8,12H,6-7H2,1H3,(H,15,17,18) |
| InChIKey | UBQKEUOLEQXJMB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|