C19H21N3O2 — CID 156795243
ethane;3-(5-methylpyrido[2,3-b]indol-9-yl)piperidine-2,6-dione (PubChem CID 156795243) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is ethane;3-(5-methylpyrido[2,3-b]indol-9-yl)piperidine-2,6-dione.
| Compound Name | ethane;3-(5-methylpyrido[2,3-b]indol-9-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 156795243 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | ethane;3-(5-methylpyrido[2,3-b]indol-9-yl)piperidine-2,6-dione |
| SMILES | CC.Cc1cccc2c1c1cccnc1n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C17H15N3O2.C2H6/c1-10-4-2-6-12-15(10)11-5-3-9-18-16(11)20(12)13-7-8-14(21)19-17(13)22;1-2/h2-6,9,13H,7-8H2,1H3,(H,19,21,22);1-2H3 |
| InChIKey | KQVOKQDLORYOJX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|