C21H27N3O2 — CID 176987810
ethane;3-[3-methyl-2-[(Z)-prop-1-enyl]pyrrolo[2,3-b]pyridin-1-yl]piperidine-2,6-dione;prop-1-yne (PubChem CID 176987810) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is ethane;3-[3-methyl-2-[(Z)-prop-1-enyl]pyrrolo[2,3-b]pyridin-1-yl]piperidine-2,6-dione;prop-1-yne.
| Compound Name | ethane;3-[3-methyl-2-[(Z)-prop-1-enyl]pyrrolo[2,3-b]pyridin-1-yl]piperidine-2,6-dione;prop-1-yne |
|---|---|
| PubChem CID | 176987810 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | ethane;3-[3-methyl-2-[(Z)-prop-1-enyl]pyrrolo[2,3-b]pyridin-1-yl]piperidine-2,6-dione;prop-1-yne |
| SMILES | C#CC.C/C=C\c1c(C)c2cccnc2n1C1CCC(=O)NC1=O.CC |
| InChI | InChI=1S/C16H17N3O2.C3H4.C2H6/c1-3-5-12-10(2)11-6-4-9-17-15(11)19(12)13-7-8-14(20)18-16(13)21;1-3-2;1-2/h3-6,9,13H,7-8H2,1-2H3,(H,18,20,21);1H,2H3;1-2H3/b5-3-;; |
| InChIKey | GEVGWKVVAWHSMF-ORIPCLHRSA-N |
| XLogP | 4.02 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|