C20H23N3O2 — CID 170584325
ethane;3-(5-ethylpyrido[2,3-b]indol-9-yl)piperidine-2,6-dione (PubChem CID 170584325) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is ethane;3-(5-ethylpyrido[2,3-b]indol-9-yl)piperidine-2,6-dione.
| Compound Name | ethane;3-(5-ethylpyrido[2,3-b]indol-9-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170584325 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | ethane;3-(5-ethylpyrido[2,3-b]indol-9-yl)piperidine-2,6-dione |
| SMILES | CC.CCc1cccc2c1c1cccnc1n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H17N3O2.C2H6/c1-2-11-5-3-7-13-16(11)12-6-4-10-19-17(12)21(13)14-8-9-15(22)20-18(14)23;1-2/h3-7,10,14H,2,8-9H2,1H3,(H,20,22,23);1-2H3 |
| InChIKey | CDNINOUCVMLNPA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|