C17H18N2O2 — CID 144735375
3-(4-ethyl-1,3-dimethylideneisoindol-2-yl)piperidine-2,6-dione (PubChem CID 144735375) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-(4-ethyl-1,3-dimethylideneisoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(4-ethyl-1,3-dimethylideneisoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 144735375 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-(4-ethyl-1,3-dimethylideneisoindol-2-yl)piperidine-2,6-dione |
| SMILES | C=c1c2cccc(CC)c2c(=C)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C17H18N2O2/c1-4-12-6-5-7-13-10(2)19(11(3)16(12)13)14-8-9-15(20)18-17(14)21/h5-7,14H,2-4,8-9H2,1H3,(H,18,20,21) |
| InChIKey | SBEVRXYABBBHBQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|