C10H13N3O2S — CID 81335588
3-(4-ethyl-2-sulfanylidene-1H-imidazol-3-yl)piperidine-2,6-dione (PubChem CID 81335588) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 3-(4-ethyl-2-sulfanylidene-1H-imidazol-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(4-ethyl-2-sulfanylidene-1H-imidazol-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 81335588 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-(4-ethyl-2-sulfanylidene-1H-imidazol-3-yl)piperidine-2,6-dione |
| SMILES | CCc1c[nH]c(=S)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C10H13N3O2S/c1-2-6-5-11-10(16)13(6)7-3-4-8(14)12-9(7)15/h5,7H,2-4H2,1H3,(H,11,16)(H,12,14,15) |
| InChIKey | FVTCMQBXKARGEG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|