C12H16N6O2 — CID 79300482
3-(5-amino-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl)piperidine-2,6-dione (PubChem CID 79300482) has the molecular formula C12H16N6O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 3-(5-amino-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl)piperidine-2,6-dione.
| Compound Name | 3-(5-amino-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 79300482 |
| Molecular Formula | C12H16N6O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 3-(5-amino-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl)piperidine-2,6-dione |
| SMILES | CCc1nn(C)c2c1nc(N)n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C12H16N6O2/c1-3-6-9-11(17(2)16-6)18(12(13)15-9)7-4-5-8(19)14-10(7)20/h7H,3-5H2,1-2H3,(H2,13,15)(H,14,19,20) |
| InChIKey | LDIDPZJZPOCKMH-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|