C17H28N2O4 — CID 177009783
ethane;3-[(4E,5E)-5-ethylidene-2-oxo-4-propylidene-1,3-oxazolidin-3-yl]piperidine-2,6-dione (PubChem CID 177009783) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is ethane;3-[(4E,5E)-5-ethylidene-2-oxo-4-propylidene-1,3-oxazolidin-3-yl]piperidine-2,6-dione.
| Compound Name | ethane;3-[(4E,5E)-5-ethylidene-2-oxo-4-propylidene-1,3-oxazolidin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177009783 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | ethane;3-[(4E,5E)-5-ethylidene-2-oxo-4-propylidene-1,3-oxazolidin-3-yl]piperidine-2,6-dione |
| SMILES | C/C=c1/oc(=O)n(C2CCC(=O)NC2=O)/c1=C/CC.CC.CC |
| InChI | InChI=1S/C13H16N2O4.2C2H6/c1-3-5-8-10(4-2)19-13(18)15(8)9-6-7-11(16)14-12(9)17;2*1-2/h4-5,9H,3,6-7H2,1-2H3,(H,14,16,17);2*1-2H3/b8-5+,10-4+;; |
| InChIKey | KRIMRUDXNRQXCK-FLIZWYPASA-N |
| XLogP | 1.46 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|