C15H19N3O3 — CID 177318647
3-[(4E,5E)-5-ethylidene-2-methyl-6-oxo-4-propylidenepyrimidin-1-yl]piperidine-2,6-dione (PubChem CID 177318647) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 3-[(4E,5E)-5-ethylidene-2-methyl-6-oxo-4-propylidenepyrimidin-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[(4E,5E)-5-ethylidene-2-methyl-6-oxo-4-propylidenepyrimidin-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177318647 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3-[(4E,5E)-5-ethylidene-2-methyl-6-oxo-4-propylidenepyrimidin-1-yl]piperidine-2,6-dione |
| SMILES | C/C=c1/c(=O)n(C2CCC(=O)NC2=O)c(C)n/c1=C/CC |
| InChI | InChI=1S/C15H19N3O3/c1-4-6-11-10(5-2)15(21)18(9(3)16-11)12-7-8-13(19)17-14(12)20/h5-6,12H,4,7-8H2,1-3H3,(H,17,19,20)/b10-5+,11-6+ |
| InChIKey | FKXXJRDTPIKCKD-YOYBCKCWSA-N |
| XLogP | -0.48 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|