C14H11Cl2N3O3 — CID 86345042
(3R)-3-(6,8-dichloro-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione (PubChem CID 86345042) has the molecular formula C14H11Cl2N3O3 and a molecular weight of 340.17 g/mol. Its IUPAC name is (3R)-3-(6,8-dichloro-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione.
| Compound Name | (3R)-3-(6,8-dichloro-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 86345042 |
| Molecular Formula | C14H11Cl2N3O3 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | (3R)-3-(6,8-dichloro-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
| SMILES | Cc1nc2c(Cl)cc(Cl)cc2c(=O)n1[C@@H]1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H11Cl2N3O3/c1-6-17-12-8(4-7(15)5-9(12)16)14(22)19(6)10-2-3-11(20)18-13(10)21/h4-5,10H,2-3H2,1H3,(H,18,20,21)/t10-/m1/s1 |
| InChIKey | SOUXXLLWQUKANK-SNVBAGLBSA-N |
| XLogP | 1.99 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|