C14H13N3O4 — CID 146598490
3-(5-hydroxy-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione (PubChem CID 146598490) has the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. Its IUPAC name is 3-(5-hydroxy-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(5-hydroxy-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 146598490 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-(5-hydroxy-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
| SMILES | Cc1nc2cccc(O)c2c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H13N3O4/c1-7-15-8-3-2-4-10(18)12(8)14(21)17(7)9-5-6-11(19)16-13(9)20/h2-4,9,18H,5-6H2,1H3,(H,16,19,20) |
| InChIKey | OLEWQBLUKROMKA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|