C17H15N3O3 — CID 155178271
3-(2-methyl-4-oxo-5-prop-1-ynylquinazolin-3-yl)piperidine-2,6-dione (PubChem CID 155178271) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 3-(2-methyl-4-oxo-5-prop-1-ynylquinazolin-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(2-methyl-4-oxo-5-prop-1-ynylquinazolin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 155178271 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 3-(2-methyl-4-oxo-5-prop-1-ynylquinazolin-3-yl)piperidine-2,6-dione |
| SMILES | CC#Cc1cccc2nc(C)n(C3CCC(=O)NC3=O)c(=O)c12 |
| InChI | InChI=1S/C17H15N3O3/c1-3-5-11-6-4-7-12-15(11)17(23)20(10(2)18-12)13-8-9-14(21)19-16(13)22/h4,6-7,13H,8-9H2,1-2H3,(H,19,21,22) |
| InChIKey | JQKSDNNOGNNAQX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|