C30H41N5O3 — CID 169093683
3-[5-[6-(1-adamantylamino)hexylamino]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione (PubChem CID 169093683) has the molecular formula C30H41N5O3 and a molecular weight of 519.69 g/mol. Its IUPAC name is 3-[5-[6-(1-adamantylamino)hexylamino]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[6-(1-adamantylamino)hexylamino]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169093683 |
| Molecular Formula | C30H41N5O3 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.32 |
| IUPAC Name | 3-[5-[6-(1-adamantylamino)hexylamino]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
| SMILES | Cc1nc2cccc(NCCCCCCNC34CC5CC(CC(C5)C3)C4)c2c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C30H41N5O3/c1-19-33-24-8-6-7-23(27(24)29(38)35(19)25-9-10-26(36)34-28(25)37)31-11-4-2-3-5-12-32-30-16-20-13-21(17-30)15-22(14-20)18-30/h6-8,20-22,25,31-32H,2-5,9-18H2,1H3,(H,34,36,37) |
| InChIKey | JHELPYNZERLBPB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|