C30H35N5O3S — CID 162728972
3-[5-[2-[5-[(1-adamantylamino)methyl]-1,3-thiazol-2-yl]ethyl]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione (PubChem CID 162728972) has the molecular formula C30H35N5O3S and a molecular weight of 545.71 g/mol. Its IUPAC name is 3-[5-[2-[5-[(1-adamantylamino)methyl]-1,3-thiazol-2-yl]ethyl]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[2-[5-[(1-adamantylamino)methyl]-1,3-thiazol-2-yl]ethyl]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162728972 |
| Molecular Formula | C30H35N5O3S |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | 3-[5-[2-[5-[(1-adamantylamino)methyl]-1,3-thiazol-2-yl]ethyl]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
| SMILES | Cc1nc2cccc(CCc3ncc(CNC45CC6CC(CC(C6)C4)C5)s3)c2c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C30H35N5O3S/c1-17-33-23-4-2-3-21(27(23)29(38)35(17)24-6-7-25(36)34-28(24)37)5-8-26-31-15-22(39-26)16-32-30-12-18-9-19(13-30)11-20(10-18)14-30/h2-4,15,18-20,24,32H,5-14,16H2,1H3,(H,34,36,37) |
| InChIKey | MEQNBCXEEFAEPS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|