C26H27N5O3S — CID 162728935
3-[5-[2-[5-(azepan-1-ylmethyl)-1,3-thiazol-2-yl]ethynyl]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione (PubChem CID 162728935) has the molecular formula C26H27N5O3S and a molecular weight of 489.60 g/mol. Its IUPAC name is 3-[5-[2-[5-(azepan-1-ylmethyl)-1,3-thiazol-2-yl]ethynyl]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[2-[5-(azepan-1-ylmethyl)-1,3-thiazol-2-yl]ethynyl]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162728935 |
| Molecular Formula | C26H27N5O3S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 3-[5-[2-[5-(azepan-1-ylmethyl)-1,3-thiazol-2-yl]ethynyl]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
| SMILES | Cc1nc2cccc(C#Cc3ncc(CN4CCCCCC4)s3)c2c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C26H27N5O3S/c1-17-28-20-8-6-7-18(24(20)26(34)31(17)21-10-11-22(32)29-25(21)33)9-12-23-27-15-19(35-23)16-30-13-4-2-3-5-14-30/h6-8,15,21H,2-5,10-11,13-14,16H2,1H3,(H,29,32,33) |
| InChIKey | RALYFXPQSTYKLU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|