C28H33N5O3 — CID 162728998
3-[8-[[4-(azepan-1-ylmethyl)phenyl]methylamino]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione (PubChem CID 162728998) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 3-[8-[[4-(azepan-1-ylmethyl)phenyl]methylamino]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[8-[[4-(azepan-1-ylmethyl)phenyl]methylamino]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162728998 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 3-[8-[[4-(azepan-1-ylmethyl)phenyl]methylamino]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
| SMILES | Cc1nc2c(NCc3ccc(CN4CCCCCC4)cc3)cccc2c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C28H33N5O3/c1-19-30-26-22(28(36)33(19)24-13-14-25(34)31-27(24)35)7-6-8-23(26)29-17-20-9-11-21(12-10-20)18-32-15-4-2-3-5-16-32/h6-12,24,29H,2-5,13-18H2,1H3,(H,31,34,35) |
| InChIKey | XUAZHAMKIVKVQD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|