C32H44N6O3 — CID 169093772
3-[8-[2-[4-[2-(1-adamantyl)ethyl]piperazin-1-yl]ethylamino]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione (PubChem CID 169093772) has the molecular formula C32H44N6O3 and a molecular weight of 560.74 g/mol. Its IUPAC name is 3-[8-[2-[4-[2-(1-adamantyl)ethyl]piperazin-1-yl]ethylamino]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[8-[2-[4-[2-(1-adamantyl)ethyl]piperazin-1-yl]ethylamino]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169093772 |
| Molecular Formula | C32H44N6O3 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.35 |
| IUPAC Name | 3-[8-[2-[4-[2-(1-adamantyl)ethyl]piperazin-1-yl]ethylamino]-2-methyl-4-oxoquinazolin-3-yl]piperidine-2,6-dione |
| SMILES | Cc1nc2c(NCCN3CCN(CCC45CC6CC(CC(C6)C4)C5)CC3)cccc2c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C32H44N6O3/c1-21-34-29-25(31(41)38(21)27-5-6-28(39)35-30(27)40)3-2-4-26(29)33-8-10-37-13-11-36(12-14-37)9-7-32-18-22-15-23(19-32)17-24(16-22)20-32/h2-4,22-24,27,33H,5-20H2,1H3,(H,35,39,40) |
| InChIKey | HJVASNWZDCRWLK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|