C24H32N4O5 — CID 167386080
tert-butyl 6-[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]amino]hexanoate (PubChem CID 167386080) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is tert-butyl 6-[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]amino]hexanoate.
| Compound Name | tert-butyl 6-[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]amino]hexanoate |
|---|---|
| PubChem CID | 167386080 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | tert-butyl 6-[[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]amino]hexanoate |
| SMILES | Cc1nc2cccc(NCCCCCC(=O)OC(C)(C)C)c2c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C24H32N4O5/c1-15-26-17-10-8-9-16(25-14-7-5-6-11-20(30)33-24(2,3)4)21(17)23(32)28(15)18-12-13-19(29)27-22(18)31/h8-10,18,25H,5-7,11-14H2,1-4H3,(H,27,29,31) |
| InChIKey | UGVUJZNAYGRIBX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|