C22H29N5O5 — CID 154675468
tert-butyl 6-[[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-5-yl]amino]hexanoate (PubChem CID 154675468) has the molecular formula C22H29N5O5 and a molecular weight of 443.50 g/mol. Its IUPAC name is tert-butyl 6-[[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-5-yl]amino]hexanoate.
| Compound Name | tert-butyl 6-[[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-5-yl]amino]hexanoate |
|---|---|
| PubChem CID | 154675468 |
| Molecular Formula | C22H29N5O5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | tert-butyl 6-[[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-5-yl]amino]hexanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCNc1cccc2nnn(C3CCC(=O)NC3=O)c(=O)c12 |
| InChI | InChI=1S/C22H29N5O5/c1-22(2,3)32-18(29)10-5-4-6-13-23-14-8-7-9-15-19(14)21(31)27(26-25-15)16-11-12-17(28)24-20(16)30/h7-9,16,23H,4-6,10-13H2,1-3H3,(H,24,28,30) |
| InChIKey | VKSLVECUBMXLFU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|