C22H32N2O4 — CID 175638791
tert-butyl 6-[3-(2,7-dioxoazepan-3-yl)anilino]hexanoate (PubChem CID 175638791) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is tert-butyl 6-[3-(2,7-dioxoazepan-3-yl)anilino]hexanoate.
| Compound Name | tert-butyl 6-[3-(2,7-dioxoazepan-3-yl)anilino]hexanoate |
|---|---|
| PubChem CID | 175638791 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | tert-butyl 6-[3-(2,7-dioxoazepan-3-yl)anilino]hexanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCNc1cccc(C2CCCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C22H32N2O4/c1-22(2,3)28-20(26)13-5-4-6-14-23-17-10-7-9-16(15-17)18-11-8-12-19(25)24-21(18)27/h7,9-10,15,18,23H,4-6,8,11-14H2,1-3H3,(H,24,25,27) |
| InChIKey | LYDZPZTVVXPIDS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|