C24H34N4O5 — CID 171843936
tert-butyl 8-[3-(2,7-dioxoazepan-3-yl)-2-oxoimidazo[4,5-b]pyridin-1-yl]octanoate (PubChem CID 171843936) has the molecular formula C24H34N4O5 and a molecular weight of 458.56 g/mol. Its IUPAC name is tert-butyl 8-[3-(2,7-dioxoazepan-3-yl)-2-oxoimidazo[4,5-b]pyridin-1-yl]octanoate.
| Compound Name | tert-butyl 8-[3-(2,7-dioxoazepan-3-yl)-2-oxoimidazo[4,5-b]pyridin-1-yl]octanoate |
|---|---|
| PubChem CID | 171843936 |
| Molecular Formula | C24H34N4O5 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | tert-butyl 8-[3-(2,7-dioxoazepan-3-yl)-2-oxoimidazo[4,5-b]pyridin-1-yl]octanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCCn1c(=O)n(C2CCCC(=O)NC2=O)c2ncccc21 |
| InChI | InChI=1S/C24H34N4O5/c1-24(2,3)33-20(30)14-7-5-4-6-8-16-27-17-12-10-15-25-21(17)28(23(27)32)18-11-9-13-19(29)26-22(18)31/h10,12,15,18H,4-9,11,13-14,16H2,1-3H3,(H,26,29,31) |
| InChIKey | KVLXHBXDVIQRCH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|