C28H41N3O9 — CID 166801083
tert-butyl 2-[2-[2-[2-[3-[1-[(3S)-2,6-dioxopiperidin-3-yl]-3-methyl-2-oxobenzimidazol-4-yl]propoxy]ethoxy]ethoxy]ethoxy]acetate (PubChem CID 166801083) has the molecular formula C28H41N3O9 and a molecular weight of 563.65 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[2-[3-[1-[(3S)-2,6-dioxopiperidin-3-yl]-3-methyl-2-oxobenzimidazol-4-yl]propoxy]ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[2-[3-[1-[(3S)-2,6-dioxopiperidin-3-yl]-3-methyl-2-oxobenzimidazol-4-yl]propoxy]ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 166801083 |
| Molecular Formula | C28H41N3O9 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | tert-butyl 2-[2-[2-[2-[3-[1-[(3S)-2,6-dioxopiperidin-3-yl]-3-methyl-2-oxobenzimidazol-4-yl]propoxy]ethoxy]ethoxy]ethoxy]acetate |
| SMILES | Cn1c(=O)n([C@H]2CCC(=O)NC2=O)c2cccc(CCCOCCOCCOCCOCC(=O)OC(C)(C)C)c21 |
| InChI | InChI=1S/C28H41N3O9/c1-28(2,3)40-24(33)19-39-18-17-38-16-15-37-14-13-36-12-6-8-20-7-5-9-21-25(20)30(4)27(35)31(21)22-10-11-23(32)29-26(22)34/h5,7,9,22H,6,8,10-19H2,1-4H3,(H,29,32,34)/t22-/m0/s1 |
| InChIKey | SKPGJQAORJNJDN-QFIPXVFZSA-N |
| XLogP | 1.66 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|