C21H27N3O5 — CID 146599287
5-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propoxy]pentanal (PubChem CID 146599287) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 5-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propoxy]pentanal.
| Compound Name | 5-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propoxy]pentanal |
|---|---|
| PubChem CID | 146599287 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 5-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propoxy]pentanal |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(CCCOCCCCC=O)c21 |
| InChI | InChI=1S/C21H27N3O5/c1-23-19-15(8-6-14-29-13-4-2-3-12-25)7-5-9-16(19)24(21(23)28)17-10-11-18(26)22-20(17)27/h5,7,9,12,17H,2-4,6,8,10-11,13-14H2,1H3,(H,22,26,27) |
| InChIKey | WVCVPVJKHQULNC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|