C21H27N3O5 — CID 146598344
tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]butanoate (PubChem CID 146598344) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]butanoate.
| Compound Name | tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]butanoate |
|---|---|
| PubChem CID | 146598344 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]butanoate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(CCCC(=O)OC(C)(C)C)c21 |
| InChI | InChI=1S/C21H27N3O5/c1-21(2,3)29-17(26)10-6-8-13-7-5-9-14-18(13)23(4)20(28)24(14)15-11-12-16(25)22-19(15)27/h5,7,9,15H,6,8,10-12H2,1-4H3,(H,22,25,27) |
| InChIKey | DHBBTOYSRVVUIL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|