C19H25FN4O4 — CID 146598833
3-[4-[3-(3-amino-2-fluoropropoxy)propyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 146598833) has the molecular formula C19H25FN4O4 and a molecular weight of 392.43 g/mol. Its IUPAC name is 3-[4-[3-(3-amino-2-fluoropropoxy)propyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[3-(3-amino-2-fluoropropoxy)propyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146598833 |
| Molecular Formula | C19H25FN4O4 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 3-[4-[3-(3-amino-2-fluoropropoxy)propyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(CCCOCC(F)CN)c21 |
| InChI | InChI=1S/C19H25FN4O4/c1-23-17-12(5-3-9-28-11-13(20)10-21)4-2-6-14(17)24(19(23)27)15-7-8-16(25)22-18(15)26/h2,4,6,13,15H,3,5,7-11,21H2,1H3,(H,22,25,26) |
| InChIKey | NHSFXKOIWJTCPL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|