C24H31N5O5 — CID 146599111
(1R,5S)-3-[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]butyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 146599111) has the molecular formula C24H31N5O5 and a molecular weight of 469.54 g/mol. Its IUPAC name is (1R,5S)-3-[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]butyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | (1R,5S)-3-[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]butyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 146599111 |
| Molecular Formula | C24H31N5O5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | (1R,5S)-3-[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]butyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(CCCCN3C[C@H]4CC[C@@H](C3)N4C(=O)O)c21 |
| InChI | InChI=1S/C24H31N5O5/c1-26-21-15(5-2-3-12-27-13-16-8-9-17(14-27)28(16)24(33)34)6-4-7-18(21)29(23(26)32)19-10-11-20(30)25-22(19)31/h4,6-7,16-17,19H,2-3,5,8-14H2,1H3,(H,33,34)(H,25,30,31)/t16-,17+,19? |
| InChIKey | VSFYNLNZBLWMKN-JJTKIYQPSA-N |
| XLogP | 1.47 |
| TPSA | 116.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|