C26H36N4O5 — CID 146599088
tert-butyl 4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propyl]piperidine-1-carboxylate (PubChem CID 146599088) has the molecular formula C26H36N4O5 and a molecular weight of 484.60 g/mol. Its IUPAC name is tert-butyl 4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146599088 |
| Molecular Formula | C26H36N4O5 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | tert-butyl 4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propyl]piperidine-1-carboxylate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(CCCC3CCN(C(=O)OC(C)(C)C)CC3)c21 |
| InChI | InChI=1S/C26H36N4O5/c1-26(2,3)35-25(34)29-15-13-17(14-16-29)7-5-8-18-9-6-10-19-22(18)28(4)24(33)30(19)20-11-12-21(31)27-23(20)32/h6,9-10,17,20H,5,7-8,11-16H2,1-4H3,(H,27,31,32) |
| InChIKey | OHHHWUIBZJRGCE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|