C20H28N4O5 — CID 155750823
3-[4-(2-methoxyethyl)-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;morpholine (PubChem CID 155750823) has the molecular formula C20H28N4O5 and a molecular weight of 404.47 g/mol. Its IUPAC name is 3-[4-(2-methoxyethyl)-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;morpholine.
| Compound Name | 3-[4-(2-methoxyethyl)-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;morpholine |
|---|---|
| PubChem CID | 155750823 |
| Molecular Formula | C20H28N4O5 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 3-[4-(2-methoxyethyl)-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;morpholine |
| SMILES | C1COCCN1.COCCc1cccc2c1n(C)c(=O)n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C16H19N3O4.C4H9NO/c1-18-14-10(8-9-23-2)4-3-5-11(14)19(16(18)22)12-6-7-13(20)17-15(12)21;1-3-6-4-2-5-1/h3-5,12H,6-9H2,1-2H3,(H,17,20,21);5H,1-4H2 |
| InChIKey | XGOJUEIJOWFSMK-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|