C26H34N4O5 — CID 163763783
tert-butyl 7-[[8-[(2,6-dioxopiperidin-3-yl)carbamoyl]quinolin-5-yl]amino]heptanoate (PubChem CID 163763783) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is tert-butyl 7-[[8-[(2,6-dioxopiperidin-3-yl)carbamoyl]quinolin-5-yl]amino]heptanoate.
| Compound Name | tert-butyl 7-[[8-[(2,6-dioxopiperidin-3-yl)carbamoyl]quinolin-5-yl]amino]heptanoate |
|---|---|
| PubChem CID | 163763783 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | tert-butyl 7-[[8-[(2,6-dioxopiperidin-3-yl)carbamoyl]quinolin-5-yl]amino]heptanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCNc1ccc(C(=O)NC2CCC(=O)NC2=O)c2ncccc12 |
| InChI | InChI=1S/C26H34N4O5/c1-26(2,3)35-22(32)10-6-4-5-7-15-27-19-12-11-18(23-17(19)9-8-16-28-23)24(33)29-20-13-14-21(31)30-25(20)34/h8-9,11-12,16,20,27H,4-7,10,13-15H2,1-3H3,(H,29,33)(H,30,31,34) |
| InChIKey | MALRKQKBYOTJMR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|