C18H22N4O7 — CID 172602571
tert-butyl N-[[3-[(2,6-dioxopiperidin-3-yl)carbamoyl]-4-nitrophenyl]methyl]carbamate (PubChem CID 172602571) has the molecular formula C18H22N4O7 and a molecular weight of 406.40 g/mol. Its IUPAC name is tert-butyl N-[[3-[(2,6-dioxopiperidin-3-yl)carbamoyl]-4-nitrophenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[(2,6-dioxopiperidin-3-yl)carbamoyl]-4-nitrophenyl]methyl]carbamate |
|---|---|
| PubChem CID | 172602571 |
| Molecular Formula | C18H22N4O7 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | tert-butyl N-[[3-[(2,6-dioxopiperidin-3-yl)carbamoyl]-4-nitrophenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc([N+](=O)[O-])c(C(=O)NC2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C18H22N4O7/c1-18(2,3)29-17(26)19-9-10-4-6-13(22(27)28)11(8-10)15(24)20-12-5-7-14(23)21-16(12)25/h4,6,8,12H,5,7,9H2,1-3H3,(H,19,26)(H,20,24)(H,21,23,25) |
| InChIKey | BMWGSMNZGNRQPO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|