C12H12ClN3O4 — CID 62896045
5-chloro-2-nitro-N-(6-oxopiperidin-3-yl)benzamide (PubChem CID 62896045) has the molecular formula C12H12ClN3O4 and a molecular weight of 297.70 g/mol. Its IUPAC name is 5-chloro-2-nitro-N-(6-oxopiperidin-3-yl)benzamide.
| Compound Name | 5-chloro-2-nitro-N-(6-oxopiperidin-3-yl)benzamide |
|---|---|
| PubChem CID | 62896045 |
| Molecular Formula | C12H12ClN3O4 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 5-chloro-2-nitro-N-(6-oxopiperidin-3-yl)benzamide |
| SMILES | O=C1CCC(NC(=O)c2cc(Cl)ccc2[N+](=O)[O-])CN1 |
| InChI | InChI=1S/C12H12ClN3O4/c13-7-1-3-10(16(19)20)9(5-7)12(18)15-8-2-4-11(17)14-6-8/h1,3,5,8H,2,4,6H2,(H,14,17)(H,15,18) |
| InChIKey | LQUOYKNNJZWLGF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|