C12H12ClFN2O2 — CID 81434409
3-chloro-4-fluoro-N-(6-oxopiperidin-3-yl)benzamide (PubChem CID 81434409) has the molecular formula C12H12ClFN2O2 and a molecular weight of 270.69 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-(6-oxopiperidin-3-yl)benzamide.
| Compound Name | 3-chloro-4-fluoro-N-(6-oxopiperidin-3-yl)benzamide |
|---|---|
| PubChem CID | 81434409 |
| Molecular Formula | C12H12ClFN2O2 |
| Molecular Weight | 270.69 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 3-chloro-4-fluoro-N-(6-oxopiperidin-3-yl)benzamide |
| SMILES | O=C1CCC(NC(=O)c2ccc(F)c(Cl)c2)CN1 |
| InChI | InChI=1S/C12H12ClFN2O2/c13-9-5-7(1-3-10(9)14)12(18)16-8-2-4-11(17)15-6-8/h1,3,5,8H,2,4,6H2,(H,15,17)(H,16,18) |
| InChIKey | BSBRDJLDRJEBNJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.69 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |