C20H17Cl2FN4O4S — CID 164877854
4-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]-3-fluoro-N-[(3S)-6-oxopiperidin-3-yl]benzamide (PubChem CID 164877854) has the molecular formula C20H17Cl2FN4O4S and a molecular weight of 499.35 g/mol. Its IUPAC name is 4-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]-3-fluoro-N-[(3S)-6-oxopiperidin-3-yl]benzamide.
| Compound Name | 4-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]-3-fluoro-N-[(3S)-6-oxopiperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 164877854 |
| Molecular Formula | C20H17Cl2FN4O4S |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | 4-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]-3-fluoro-N-[(3S)-6-oxopiperidin-3-yl]benzamide |
| SMILES | O=C1CC[C@H](NC(=O)c2ccc(S(=O)(=O)Nc3ccc(Cl)c4c(Cl)c[nH]c34)c(F)c2)CN1 |
| InChI | InChI=1S/C20H17Cl2FN4O4S/c21-12-3-4-15(19-18(12)13(22)9-25-19)27-32(30,31)16-5-1-10(7-14(16)23)20(29)26-11-2-6-17(28)24-8-11/h1,3-5,7,9,11,25,27H,2,6,8H2,(H,24,28)(H,26,29)/t11-/m0/s1 |
| InChIKey | ZTRAJOJVRKSJQR-NSHDSACASA-N |
| XLogP | 3.42 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |