C23H23Cl2FN4O4S — CID 164877697
4-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]-3-fluoro-N-(4-oxo-4-pyrrolidin-1-ylbutyl)benzamide (PubChem CID 164877697) has the molecular formula C23H23Cl2FN4O4S and a molecular weight of 541.43 g/mol. Its IUPAC name is 4-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]-3-fluoro-N-(4-oxo-4-pyrrolidin-1-ylbutyl)benzamide.
| Compound Name | 4-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]-3-fluoro-N-(4-oxo-4-pyrrolidin-1-ylbutyl)benzamide |
|---|---|
| PubChem CID | 164877697 |
| Molecular Formula | C23H23Cl2FN4O4S |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | 4-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]-3-fluoro-N-(4-oxo-4-pyrrolidin-1-ylbutyl)benzamide |
| SMILES | O=C(NCCCC(=O)N1CCCC1)c1ccc(S(=O)(=O)Nc2ccc(Cl)c3c(Cl)c[nH]c23)c(F)c1 |
| InChI | InChI=1S/C23H23Cl2FN4O4S/c24-15-6-7-18(22-21(15)16(25)13-28-22)29-35(33,34)19-8-5-14(12-17(19)26)23(32)27-9-3-4-20(31)30-10-1-2-11-30/h5-8,12-13,28-29H,1-4,9-11H2,(H,27,32) |
| InChIKey | OLIZBBDUUJLPCI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|