C19H19Cl2N3O3S2 — CID 164863600
N-(3,4-dichloro-1H-indol-7-yl)-4-piperidin-1-ylsulfinylbenzenesulfonamide (PubChem CID 164863600) has the molecular formula C19H19Cl2N3O3S2 and a molecular weight of 472.42 g/mol. Its IUPAC name is N-(3,4-dichloro-1H-indol-7-yl)-4-piperidin-1-ylsulfinylbenzenesulfonamide.
| Compound Name | N-(3,4-dichloro-1H-indol-7-yl)-4-piperidin-1-ylsulfinylbenzenesulfonamide |
|---|---|
| PubChem CID | 164863600 |
| Molecular Formula | C19H19Cl2N3O3S2 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | N-(3,4-dichloro-1H-indol-7-yl)-4-piperidin-1-ylsulfinylbenzenesulfonamide |
| SMILES | O=S(c1ccc(S(=O)(=O)Nc2ccc(Cl)c3c(Cl)c[nH]c23)cc1)N1CCCCC1 |
| InChI | InChI=1S/C19H19Cl2N3O3S2/c20-15-8-9-17(19-18(15)16(21)12-22-19)23-29(26,27)14-6-4-13(5-7-14)28(25)24-10-2-1-3-11-24/h4-9,12,22-23H,1-3,10-11H2 |
| InChIKey | YSBFMPVGJCSFAM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |